C20H13N2O5S- — CID 5101510
3-hydroxy-4-[(1-hydroxynaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate (PubChem CID 5101510) has the molecular formula C20H13N2O5S- and a molecular weight of 393.40 g/mol. Its IUPAC name is 3-hydroxy-4-[(1-hydroxynaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate.
| Compound Name | 3-hydroxy-4-[(1-hydroxynaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 5101510 |
| Molecular Formula | C20H13N2O5S- |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 3-hydroxy-4-[(1-hydroxynaphthalen-2-yl)diazenyl]naphthalene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1cc(O)c(/N=N/c2ccc3ccccc3c2O)c2ccccc12 |
| InChI | InChI=1S/C20H14N2O5S/c23-17-11-18(28(25,26)27)14-7-3-4-8-15(14)19(17)22-21-16-10-9-12-5-1-2-6-13(12)20(16)24/h1-11,23-24H,(H,25,26,27)/p-1/b22-21+ |
| InChIKey | BRDGZOLJYALNOY-QURGRASLSA-M |
| XLogP | 4.72 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|