C17H10N2Na2O6S — CID 170847012
disodium;2-oxido-5-[(6-sulfonaphthalen-1-yl)diazenyl]benzoate (PubChem CID 170847012) has the molecular formula C17H10N2Na2O6S and a molecular weight of 416.32 g/mol. Its IUPAC name is disodium;2-oxido-5-[(6-sulfonaphthalen-1-yl)diazenyl]benzoate.
| Compound Name | disodium;2-oxido-5-[(6-sulfonaphthalen-1-yl)diazenyl]benzoate |
|---|---|
| PubChem CID | 170847012 |
| Molecular Formula | C17H10N2Na2O6S |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | disodium;2-oxido-5-[(6-sulfonaphthalen-1-yl)diazenyl]benzoate |
| SMILES | O=C([O-])c1cc(/N=N/c2cccc3cc(S(=O)(=O)O)ccc23)ccc1[O-].[Na+].[Na+] |
| InChI | InChI=1S/C17H12N2O6S.2Na/c20-16-7-4-11(9-14(16)17(21)22)18-19-15-3-1-2-10-8-12(26(23,24)25)5-6-13(10)15;;/h1-9,20H,(H,21,22)(H,23,24,25);;/q;2*+1/p-2/b19-18+;; |
| InChIKey | KRMMXHNDUUBEBL-BUFQOAPZSA-L |
| XLogP | -4.05 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | -4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|