C33H26N8O12S4 — CID 90471156
3,5-diamino-2-[(1,5-disulfonaphthalen-2-yl)diazenyl]-4,6-bis[(4-ethenylsulfonylphenyl)diazenyl]benzoic acid (PubChem CID 90471156) has the molecular formula C33H26N8O12S4 and a molecular weight of 854.88 g/mol. Its IUPAC name is 3,5-diamino-2-[(1,5-disulfonaphthalen-2-yl)diazenyl]-4,6-bis[(4-ethenylsulfonylphenyl)diazenyl]benzoic acid.
| Compound Name | 3,5-diamino-2-[(1,5-disulfonaphthalen-2-yl)diazenyl]-4,6-bis[(4-ethenylsulfonylphenyl)diazenyl]benzoic acid |
|---|---|
| PubChem CID | 90471156 |
| Molecular Formula | C33H26N8O12S4 |
| Molecular Weight | 854.88 g/mol |
| Exact Mass | 854.06 |
| IUPAC Name | 3,5-diamino-2-[(1,5-disulfonaphthalen-2-yl)diazenyl]-4,6-bis[(4-ethenylsulfonylphenyl)diazenyl]benzoic acid |
| SMILES | C=CS(=O)(=O)c1ccc(/N=N/c2c(N)c(/N=N/c3ccc(S(=O)(=O)C=C)cc3)c(C(=O)O)c(/N=N/c3ccc4c(S(=O)(=O)O)cccc4c3S(=O)(=O)O)c2N)cc1 |
| InChI | InChI=1S/C33H26N8O12S4/c1-3-54(44,45)20-12-8-18(9-13-20)36-39-29-26(33(42)43)30(28(35)31(27(29)34)41-37-19-10-14-21(15-11-19)55(46,47)4-2)40-38-24-17-16-22-23(32(24)57(51,52)53)6-5-7-25(22)56(48,49)50/h3-17H,1-2,34-35H2,(H,42,43)(H,48,49,50)(H,51,52,53)/b39-36+,40-38+,41-37+ |
| InChIKey | OECKHONBGTWMLL-UPMJBUMYSA-N |
| XLogP | 7.28 |
| TPSA | 340.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.88 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|