C18H17N3O5S2 — CID 59012389
6-amino-5-[(4-ethylsulfonylphenyl)diazenyl]naphthalene-1-sulfonic acid (PubChem CID 59012389) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is 6-amino-5-[(4-ethylsulfonylphenyl)diazenyl]naphthalene-1-sulfonic acid.
| Compound Name | 6-amino-5-[(4-ethylsulfonylphenyl)diazenyl]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 59012389 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | 6-amino-5-[(4-ethylsulfonylphenyl)diazenyl]naphthalene-1-sulfonic acid |
| SMILES | CCS(=O)(=O)c1ccc(/N=N/c2c(N)ccc3c(S(=O)(=O)O)cccc23)cc1 |
| InChI | InChI=1S/C18H17N3O5S2/c1-2-27(22,23)13-8-6-12(7-9-13)20-21-18-15-4-3-5-17(28(24,25)26)14(15)10-11-16(18)19/h3-11H,2,19H2,1H3,(H,24,25,26)/b21-20+ |
| InChIKey | NMWOYHXECITYQN-QZQOTICOSA-N |
| XLogP | 3.88 |
| TPSA | 139.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|