C34H28N4O — CID 135597564
1-[[4-[(6,8-dimethylnaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3,6-dimethylnaphthalen-2-ol (PubChem CID 135597564) has the molecular formula C34H28N4O and a molecular weight of 508.63 g/mol. Its IUPAC name is 1-[[4-[(6,8-dimethylnaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3,6-dimethylnaphthalen-2-ol.
| Compound Name | 1-[[4-[(6,8-dimethylnaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3,6-dimethylnaphthalen-2-ol |
|---|---|
| PubChem CID | 135597564 |
| Molecular Formula | C34H28N4O |
| Molecular Weight | 508.63 g/mol |
| Exact Mass | 508.23 |
| IUPAC Name | 1-[[4-[(6,8-dimethylnaphthalen-2-yl)diazenyl]naphthalen-1-yl]diazenyl]-3,6-dimethylnaphthalen-2-ol |
| SMILES | Cc1cc(C)c2cc(/N=N/c3ccc(/N=N/c4c(O)c(C)cc5cc(C)ccc45)c4ccccc34)ccc2c1 |
| InChI | InChI=1S/C34H28N4O/c1-20-9-12-27-25(16-20)18-23(4)34(39)33(27)38-37-32-14-13-31(28-7-5-6-8-29(28)32)36-35-26-11-10-24-17-21(2)15-22(3)30(24)19-26/h5-19,39H,1-4H3/b36-35+,38-37+ |
| InChIKey | BBYLUZUBWIEZOA-JKWOPUAESA-N |
| XLogP | 10.92 |
| TPSA | 69.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.63 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|