C30H24N8O2 — CID 137279923
2-[[2-hydroxy-4-[[4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-6-methylnaphthalen-1-ol (PubChem CID 137279923) has the molecular formula C30H24N8O2 and a molecular weight of 528.58 g/mol. Its IUPAC name is 2-[[2-hydroxy-4-[[4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-6-methylnaphthalen-1-ol.
| Compound Name | 2-[[2-hydroxy-4-[[4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-6-methylnaphthalen-1-ol |
|---|---|
| PubChem CID | 137279923 |
| Molecular Formula | C30H24N8O2 |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | 2-[[2-hydroxy-4-[[4-[[4-(methyldiazenyl)phenyl]diazenyl]phenyl]diazenyl]phenyl]diazenyl]-6-methylnaphthalen-1-ol |
| SMILES | C/N=N/c1ccc(/N=N/c2ccc(/N=N/c3ccc(/N=N/c4ccc5cc(C)ccc5c4O)c(O)c3)cc2)cc1 |
| InChI | InChI=1S/C30H24N8O2/c1-19-3-14-26-20(17-19)4-15-28(30(26)40)38-37-27-16-13-25(18-29(27)39)36-35-24-11-9-23(10-12-24)34-33-22-7-5-21(6-8-22)32-31-2/h3-18,39-40H,1-2H3/b32-31+,34-33+,36-35+,38-37+ |
| InChIKey | YRIAYGYBEVUWQB-HNISISPFSA-N |
| XLogP | 10.52 |
| TPSA | 139.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|