C17H14N2O3 — CID 137230625
2-[(4-methoxyphenyl)diazenyl]naphthalene-1,5-diol (PubChem CID 137230625) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)diazenyl]naphthalene-1,5-diol.
| Compound Name | 2-[(4-methoxyphenyl)diazenyl]naphthalene-1,5-diol |
|---|---|
| PubChem CID | 137230625 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(4-methoxyphenyl)diazenyl]naphthalene-1,5-diol |
| SMILES | COc1ccc(/N=N/c2ccc3c(O)cccc3c2O)cc1 |
| InChI | InChI=1S/C17H14N2O3/c1-22-12-7-5-11(6-8-12)18-19-15-10-9-13-14(17(15)21)3-2-4-16(13)20/h2-10,20-21H,1H3/b19-18+ |
| InChIKey | BRAMJJFKHZCYQW-VHEBQXMUSA-N |
| XLogP | 4.68 |
| TPSA | 74.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|