About bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+)
bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) (PubChem CID 171977429) has the molecular formula C26H22N4NiO2S2
and a molecular weight of 545.32 g/mol. Its IUPAC name is bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+).
Molecular Properties
| Compound Name | bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) |
| PubChem CID | 171977429 |
| Molecular Formula | C26H22N4NiO2S2 |
| Molecular Weight | 545.32 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) |
| SMILES | COc1ccc(/N=N/c2ccccc2[S-])cc1.COc1ccc(/N=N/c2ccccc2[S-])cc1.[Ni+2] |
| InChI | InChI=1S/2C13H12N2OS.Ni/c2*1-16-11-8-6-10(7-9-11)14-15-12-4-2-3-5-13(12)17;/h2*2-9,17H,1H3;/q;;+2/p-2/b2*15-14+; |
| InChIKey | GYXRNRAWMWZQLI-HCQSJYOASA-L |
| XLogP | 8.03 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.32 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+)?
The IUPAC name of bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) (CID 171977429) is bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+).
What is the SMILES notation for bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+)?
The canonical SMILES for bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) is COc1ccc(/N=N/c2ccccc2[S-])cc1.COc1ccc(/N=N/c2ccccc2[S-])cc1.[Ni+2].
What is the InChIKey of bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+)?
The InChIKey is GYXRNRAWMWZQLI-HCQSJYOASA-L. The full InChI is InChI=1S/2C13H12N2OS.Ni/c2*1-16-11-8-6-10(7-9-11)14-15-12-4-2-3-5-13(12)17;/h2*2-9,17H,1H3;/q;;+2/p-2/b2*15-14+;.
What are the key properties of bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+)?
bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) has a molecular weight of 545.32 g/mol, XLogP of 8.03, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-[(4-methoxyphenyl)diazenyl]benzenethiolate);nickel(2+) is sourced from PubChem (CID 171977429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).