About 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride
2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride (PubChem CID 50923657) has the molecular formula C14H12ClNOPdS
and a molecular weight of 384.20 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride.
Molecular Properties
| Compound Name | 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride |
| PubChem CID | 50923657 |
| Molecular Formula | C14H12ClNOPdS |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 382.94 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride |
| SMILES | COc1ccc(/[C-]=N/c2ccccc2[S-])cc1.Cl.[Pd+2] |
| InChI | InChI=1S/C14H12NOS.ClH.Pd/c1-16-12-8-6-11(7-9-12)10-15-13-4-2-3-5-14(13)17;;/h2-9,17H,1H3;1H;/q-1;;+2/p-1 |
| InChIKey | PWRBODFUTQNAEO-UHFFFAOYSA-M |
| XLogP | 3.65 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride?
The IUPAC name of 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride (CID 50923657) is 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride.
What is the SMILES notation for 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride?
The canonical SMILES for 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride is COc1ccc(/[C-]=N/c2ccccc2[S-])cc1.Cl.[Pd+2].
What is the InChIKey of 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride?
The InChIKey is PWRBODFUTQNAEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H12NOS.ClH.Pd/c1-16-12-8-6-11(7-9-12)10-15-13-4-2-3-5-14(13)17;;/h2-9,17H,1H3;1H;/q-1;;+2/p-1.
What are the key properties of 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride?
2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride has a molecular weight of 384.20 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxyphenyl)methylideneamino]benzenethiolate;palladium(2+);hydrochloride is sourced from PubChem (CID 50923657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).