About CID 102206658
CID 102206658 (PubChem CID 102206658) has the molecular formula C11H15N4O2
and a molecular weight of 235.27 g/mol.
Molecular Properties
| Compound Name | CID 102206658 |
| PubChem CID | 102206658 |
| Molecular Formula | C11H15N4O2 |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | — |
| SMILES | COc1ccc([C]2NN(C)C(=O)N(C)N2)cc1 |
| InChI | InChI=1S/C11H15N4O2/c1-14-11(16)15(2)13-10(12-14)8-4-6-9(17-3)7-5-8/h4-7,12-13H,1-3H3 |
| InChIKey | AWFKZZFLFGAPOK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 102206658 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102206658?
The IUPAC name of CID 102206658 (CID 102206658) is not available.
What is the SMILES notation for CID 102206658?
The canonical SMILES for CID 102206658 is COc1ccc([C]2NN(C)C(=O)N(C)N2)cc1.
What is the InChIKey of CID 102206658?
The InChIKey is AWFKZZFLFGAPOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N4O2/c1-14-11(16)15(2)13-10(12-14)8-4-6-9(17-3)7-5-8/h4-7,12-13H,1-3H3.
What are the key properties of CID 102206658?
CID 102206658 has a molecular weight of 235.27 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102206658 is sourced from PubChem (CID 102206658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).