C10H13N3O — CID 163455076
5-(4-methoxyphenyl)-2-methyl-1,3-dihydro-1,2,4-triazole (PubChem CID 163455076) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-2-methyl-1,3-dihydro-1,2,4-triazole.
| Compound Name | 5-(4-methoxyphenyl)-2-methyl-1,3-dihydro-1,2,4-triazole |
|---|---|
| PubChem CID | 163455076 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 5-(4-methoxyphenyl)-2-methyl-1,3-dihydro-1,2,4-triazole |
| SMILES | COc1ccc(C2=NCN(C)N2)cc1 |
| InChI | InChI=1S/C10H13N3O/c1-13-7-11-10(12-13)8-3-5-9(14-2)6-4-8/h3-6H,7H2,1-2H3,(H,11,12) |
| InChIKey | BJTJOSHKJHYORD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |