C16H12N2O3 — CID 137230626
2-[(4-hydroxyphenyl)diazenyl]naphthalene-1,5-diol (PubChem CID 137230626) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[(4-hydroxyphenyl)diazenyl]naphthalene-1,5-diol.
| Compound Name | 2-[(4-hydroxyphenyl)diazenyl]naphthalene-1,5-diol |
|---|---|
| PubChem CID | 137230626 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[(4-hydroxyphenyl)diazenyl]naphthalene-1,5-diol |
| SMILES | Oc1ccc(/N=N/c2ccc3c(O)cccc3c2O)cc1 |
| InChI | InChI=1S/C16H12N2O3/c19-11-6-4-10(5-7-11)17-18-14-9-8-12-13(16(14)21)2-1-3-15(12)20/h1-9,19-21H/b18-17+ |
| InChIKey | PHAIWNLEZGQEFA-ISLYRVAYSA-N |
| XLogP | 4.37 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|