C17H12N4O4 — CID 2863650
5-[(4-benzoylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione (PubChem CID 2863650) has the molecular formula C17H12N4O4 and a molecular weight of 336.31 g/mol. Its IUPAC name is 5-[(4-benzoylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[(4-benzoylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2863650 |
| Molecular Formula | C17H12N4O4 |
| Molecular Weight | 336.31 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 5-[(4-benzoylphenyl)diazenyl]-6-hydroxy-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1ccccc1)c1ccc(/N=N/c2c(O)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C17H12N4O4/c22-14(10-4-2-1-3-5-10)11-6-8-12(9-7-11)20-21-13-15(23)18-17(25)19-16(13)24/h1-9H,(H3,18,19,23,24,25)/b21-20+ |
| InChIKey | GRWJCXDHSAFBCZ-QZQOTICOSA-N |
| XLogP | 2.42 |
| TPSA | 127.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|