C12H13N3O2 — CID 12659494
6-amino-5-[(4-methylphenyl)methyl]-1H-pyrimidine-2,4-dione (PubChem CID 12659494) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 6-amino-5-[(4-methylphenyl)methyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(4-methylphenyl)methyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12659494 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 6-amino-5-[(4-methylphenyl)methyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1ccc(Cc2c(N)[nH]c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C12H13N3O2/c1-7-2-4-8(5-3-7)6-9-10(13)14-12(17)15-11(9)16/h2-5H,6H2,1H3,(H4,13,14,15,16,17) |
| InChIKey | UBWAEPVZGGSHPG-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |