C19H13N3OS — CID 172635295
11,13-dimethyl-4-oxo-6-phenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaene-5-carbonitrile (PubChem CID 172635295) has the molecular formula C19H13N3OS and a molecular weight of 331.40 g/mol. Its IUPAC name is 11,13-dimethyl-4-oxo-6-phenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaene-5-carbonitrile.
| Compound Name | 11,13-dimethyl-4-oxo-6-phenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaene-5-carbonitrile |
|---|---|
| PubChem CID | 172635295 |
| Molecular Formula | C19H13N3OS |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 11,13-dimethyl-4-oxo-6-phenyl-8-thia-3,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaene-5-carbonitrile |
| SMILES | Cc1cc(C)c2c(n1)sc1c(-c3ccccc3)c(C#N)c(=O)[nH]c12 |
| InChI | InChI=1S/C19H13N3OS/c1-10-8-11(2)21-19-14(10)16-17(24-19)15(12-6-4-3-5-7-12)13(9-20)18(23)22-16/h3-8H,1-2H3,(H,22,23) |
| InChIKey | DTFSHGKJKNGFDG-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |