C30H22N4O — CID 102170072
5-[(2,6-dimethylphenyl)diazenyl]-2-oxo-4,6-diphenyl-1H-quinoline-3-carbonitrile (PubChem CID 102170072) has the molecular formula C30H22N4O and a molecular weight of 454.53 g/mol. Its IUPAC name is 5-[(2,6-dimethylphenyl)diazenyl]-2-oxo-4,6-diphenyl-1H-quinoline-3-carbonitrile.
| Compound Name | 5-[(2,6-dimethylphenyl)diazenyl]-2-oxo-4,6-diphenyl-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 102170072 |
| Molecular Formula | C30H22N4O |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | 5-[(2,6-dimethylphenyl)diazenyl]-2-oxo-4,6-diphenyl-1H-quinoline-3-carbonitrile |
| SMILES | Cc1cccc(C)c1/N=N/c1c(-c2ccccc2)ccc2[nH]c(=O)c(C#N)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C30H22N4O/c1-19-10-9-11-20(2)28(19)33-34-29-23(21-12-5-3-6-13-21)16-17-25-27(29)26(22-14-7-4-8-15-22)24(18-31)30(35)32-25/h3-17H,1-2H3,(H,32,35)/b34-33+ |
| InChIKey | UVJOLYJTKOWHEN-JEIPZWNWSA-N |
| XLogP | 7.77 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|