C22H14N2O3 — CID 54746301
4-hydroxy-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinoline-3-carbonitrile (PubChem CID 54746301) has the molecular formula C22H14N2O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 4-hydroxy-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinoline-3-carbonitrile.
| Compound Name | 4-hydroxy-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 54746301 |
| Molecular Formula | C22H14N2O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 4-hydroxy-5-[4-(2-hydroxyphenyl)phenyl]-2-oxo-1H-quinoline-3-carbonitrile |
| SMILES | N#Cc1c(O)c2c(-c3ccc(-c4ccccc4O)cc3)cccc2[nH]c1=O |
| InChI | InChI=1S/C22H14N2O3/c23-12-17-21(26)20-16(5-3-6-18(20)24-22(17)27)14-10-8-13(9-11-14)15-4-1-2-7-19(15)25/h1-11,25H,(H2,24,26,27) |
| InChIKey | ARUYJUKHVNUTNP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |