C18H18N2OS — CID 121479838
N-ethyl-4,6-dimethyl-3-phenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 121479838) has the molecular formula C18H18N2OS and a molecular weight of 310.42 g/mol. Its IUPAC name is N-ethyl-4,6-dimethyl-3-phenylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | N-ethyl-4,6-dimethyl-3-phenylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 121479838 |
| Molecular Formula | C18H18N2OS |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | N-ethyl-4,6-dimethyl-3-phenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCNC(=O)c1sc2nc(C)cc(C)c2c1-c1ccccc1 |
| InChI | InChI=1S/C18H18N2OS/c1-4-19-17(21)16-15(13-8-6-5-7-9-13)14-11(2)10-12(3)20-18(14)22-16/h5-10H,4H2,1-3H3,(H,19,21) |
| InChIKey | VHTPOJWOUJWHQL-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |