About N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide
N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 121479827) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| PubChem CID | 121479827 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc2c(C)cc(C)nc2s1 |
| InChI | InChI=1S/C12H14N2OS/c1-4-13-11(15)10-6-9-7(2)5-8(3)14-12(9)16-10/h5-6H,4H2,1-3H3,(H,13,15) |
| InChIKey | IUSRKFRURYXLHZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The IUPAC name of N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide (CID 121479827) is N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide.
What is the SMILES notation for N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The canonical SMILES for N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide is CCNC(=O)c1cc2c(C)cc(C)nc2s1.
What is the InChIKey of N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
The InChIKey is IUSRKFRURYXLHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c1-4-13-11(15)10-6-9-7(2)5-8(3)14-12(9)16-10/h5-6H,4H2,1-3H3,(H,13,15).
What are the key properties of N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide?
N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide has a molecular weight of 234.32 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide is sourced from PubChem (CID 121479827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).