C21H27N5O2S — CID 59519308
2-amino-N-ethyl-4-[5-[(3-methoxypropylamino)methyl]-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59519308) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is 2-amino-N-ethyl-4-[5-[(3-methoxypropylamino)methyl]-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-N-ethyl-4-[5-[(3-methoxypropylamino)methyl]-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59519308 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 2-amino-N-ethyl-4-[5-[(3-methoxypropylamino)methyl]-2-methylphenyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCNC(=O)c1cc2c(-c3cc(CNCCCOC)ccc3C)nc(N)nc2s1 |
| InChI | InChI=1S/C21H27N5O2S/c1-4-24-19(27)17-11-16-18(25-21(22)26-20(16)29-17)15-10-14(7-6-13(15)2)12-23-8-5-9-28-3/h6-7,10-11,23H,4-5,8-9,12H2,1-3H3,(H,24,27)(H2,22,25,26) |
| InChIKey | OMEGDMHZPGGCRI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|