C21H18N4OS — CID 11176281
2-amino-4-phenyl-N-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 11176281) has the molecular formula C21H18N4OS and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-amino-4-phenyl-N-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-4-phenyl-N-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 11176281 |
| Molecular Formula | C21H18N4OS |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-amino-4-phenyl-N-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Nc1nc(-c2ccccc2)c2cc(C(=O)NCCc3ccccc3)sc2n1 |
| InChI | InChI=1S/C21H18N4OS/c22-21-24-18(15-9-5-2-6-10-15)16-13-17(27-20(16)25-21)19(26)23-12-11-14-7-3-1-4-8-14/h1-10,13H,11-12H2,(H,23,26)(H2,22,24,25) |
| InChIKey | QHDPZYPNCLOIAG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |