C17H18N4OS — CID 59519285
2-amino-N-butan-2-yl-4-phenylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59519285) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 2-amino-N-butan-2-yl-4-phenylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-N-butan-2-yl-4-phenylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59519285 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-amino-N-butan-2-yl-4-phenylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCC(C)NC(=O)c1cc2c(-c3ccccc3)nc(N)nc2s1 |
| InChI | InChI=1S/C17H18N4OS/c1-3-10(2)19-15(22)13-9-12-14(11-7-5-4-6-8-11)20-17(18)21-16(12)23-13/h4-10H,3H2,1-2H3,(H,19,22)(H2,18,20,21) |
| InChIKey | PSQCARAQMSQMAX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |