C23H26N4O2S — CID 143009752
2-amino-4-(3-ethoxyphenyl)-N-methylthieno[2,3-d]pyrimidine-6-carboxamide;(3Z,5Z)-hepta-1,3,5-triene (PubChem CID 143009752) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-amino-4-(3-ethoxyphenyl)-N-methylthieno[2,3-d]pyrimidine-6-carboxamide;(3Z,5Z)-hepta-1,3,5-triene.
| Compound Name | 2-amino-4-(3-ethoxyphenyl)-N-methylthieno[2,3-d]pyrimidine-6-carboxamide;(3Z,5Z)-hepta-1,3,5-triene |
|---|---|
| PubChem CID | 143009752 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-amino-4-(3-ethoxyphenyl)-N-methylthieno[2,3-d]pyrimidine-6-carboxamide;(3Z,5Z)-hepta-1,3,5-triene |
| SMILES | C=C/C=C\C=C/C.CCOc1cccc(-c2nc(N)nc3sc(C(=O)NC)cc23)c1 |
| InChI | InChI=1S/C16H16N4O2S.C7H10/c1-3-22-10-6-4-5-9(7-10)13-11-8-12(14(21)18-2)23-15(11)20-16(17)19-13;1-3-5-7-6-4-2/h4-8H,3H2,1-2H3,(H,18,21)(H2,17,19,20);3-7H,1H2,2H3/b;6-4-,7-5- |
| InChIKey | RQWNUNLROBDGJJ-WRFMUYTLSA-N |
| XLogP | 5.00 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|