C15H15N5O2S2 — CID 143267005
2-amino-N-ethyl-4-[(Z)-N-methoxy-C-thiophen-2-ylcarbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 143267005) has the molecular formula C15H15N5O2S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-amino-N-ethyl-4-[(Z)-N-methoxy-C-thiophen-2-ylcarbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-N-ethyl-4-[(Z)-N-methoxy-C-thiophen-2-ylcarbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 143267005 |
| Molecular Formula | C15H15N5O2S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-amino-N-ethyl-4-[(Z)-N-methoxy-C-thiophen-2-ylcarbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCNC(=O)c1cc2c(/C(=N/OC)c3cccs3)nc(N)nc2s1 |
| InChI | InChI=1S/C15H15N5O2S2/c1-3-17-13(21)10-7-8-11(18-15(16)19-14(8)24-10)12(20-22-2)9-5-4-6-23-9/h4-7H,3H2,1-2H3,(H,17,21)(H2,16,18,19)/b20-12+ |
| InChIKey | PWAARDBPXQBARC-UDWIEESQSA-N |
| XLogP | 2.48 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|