C17H15N5O3S — CID 88961492
2-amino-4-(1,3-benzodioxole-5-carboximidoyl)-N-ethylthieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 88961492) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 2-amino-4-(1,3-benzodioxole-5-carboximidoyl)-N-ethylthieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-4-(1,3-benzodioxole-5-carboximidoyl)-N-ethylthieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 88961492 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-amino-4-(1,3-benzodioxole-5-carboximidoyl)-N-ethylthieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | [H]/N=C(\c1ccc2c(c1)OCO2)c1nc(N)nc2sc(C(=O)NCC)cc12 |
| InChI | InChI=1S/C17H15N5O3S/c1-2-20-15(23)12-6-9-14(21-17(19)22-16(9)26-12)13(18)8-3-4-10-11(5-8)25-7-24-10/h3-6,18H,2,7H2,1H3,(H,20,23)(H2,19,21,22)/b18-13+ |
| InChIKey | ZEWMGOOGJCSVDP-QGOAFFKASA-N |
| XLogP | 2.17 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|