C17H14N4O4S — CID 143266998
ethyl 2-amino-4-(1,3-benzodioxole-5-carboximidoyl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 143266998) has the molecular formula C17H14N4O4S and a molecular weight of 370.39 g/mol. Its IUPAC name is ethyl 2-amino-4-(1,3-benzodioxole-5-carboximidoyl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-amino-4-(1,3-benzodioxole-5-carboximidoyl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 143266998 |
| Molecular Formula | C17H14N4O4S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | ethyl 2-amino-4-(1,3-benzodioxole-5-carboximidoyl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | [H]/N=C(\c1ccc2c(c1)OCO2)c1nc(N)nc2sc(C(=O)OCC)cc12 |
| InChI | InChI=1S/C17H14N4O4S/c1-2-23-16(22)12-6-9-14(20-17(19)21-15(9)26-12)13(18)8-3-4-10-11(5-8)25-7-24-10/h3-6,18H,2,7H2,1H3,(H2,19,20,21)/b18-13+ |
| InChIKey | VRVGHRMXHOWNNP-QGOAFFKASA-N |
| XLogP | 2.60 |
| TPSA | 120.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|