C16H12ClN3O3S — CID 59519335
ethyl 2-amino-4-(3-chlorobenzoyl)thieno[2,3-d]pyrimidine-6-carboxylate (PubChem CID 59519335) has the molecular formula C16H12ClN3O3S and a molecular weight of 361.81 g/mol. Its IUPAC name is ethyl 2-amino-4-(3-chlorobenzoyl)thieno[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | ethyl 2-amino-4-(3-chlorobenzoyl)thieno[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 59519335 |
| Molecular Formula | C16H12ClN3O3S |
| Molecular Weight | 361.81 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | ethyl 2-amino-4-(3-chlorobenzoyl)thieno[2,3-d]pyrimidine-6-carboxylate |
| SMILES | CCOC(=O)c1cc2c(C(=O)c3cccc(Cl)c3)nc(N)nc2s1 |
| InChI | InChI=1S/C16H12ClN3O3S/c1-2-23-15(22)11-7-10-12(19-16(18)20-14(10)24-11)13(21)8-4-3-5-9(17)6-8/h3-7H,2H2,1H3,(H2,18,19,20) |
| InChIKey | WMJNRABGDSIVCZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.81 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |