C24H28N6O5S — CID 11555319
2-amino-4-[(Z)-C-(1,3-benzodioxol-5-yl)-N-(2-pyrrolidin-1-ylethoxy)carbonimidoyl]-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 11555319) has the molecular formula C24H28N6O5S and a molecular weight of 512.59 g/mol. Its IUPAC name is 2-amino-4-[(Z)-C-(1,3-benzodioxol-5-yl)-N-(2-pyrrolidin-1-ylethoxy)carbonimidoyl]-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-4-[(Z)-C-(1,3-benzodioxol-5-yl)-N-(2-pyrrolidin-1-ylethoxy)carbonimidoyl]-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 11555319 |
| Molecular Formula | C24H28N6O5S |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | 2-amino-4-[(Z)-C-(1,3-benzodioxol-5-yl)-N-(2-pyrrolidin-1-ylethoxy)carbonimidoyl]-N-(2-methoxyethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | COCCNC(=O)c1cc2c(/C(=N\OCCN3CCCC3)c3ccc4c(c3)OCO4)nc(N)nc2s1 |
| InChI | InChI=1S/C24H28N6O5S/c1-32-10-6-26-22(31)19-13-16-21(27-24(25)28-23(16)36-19)20(29-35-11-9-30-7-2-3-8-30)15-4-5-17-18(12-15)34-14-33-17/h4-5,12-13H,2-3,6-11,14H2,1H3,(H,26,31)(H2,25,27,28)/b29-20- |
| InChIKey | LACNOXSAVGBFMW-BRPDVVIDSA-N |
| XLogP | 2.24 |
| TPSA | 133.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|