C15H17N3O3S — CID 119506283
2-(1,3-benzodioxol-5-yl)-N-[2-(ethylamino)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 119506283) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[2-(ethylamino)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[2-(ethylamino)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119506283 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[2-(ethylamino)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCNCCNC(=O)c1cnc(-c2ccc3c(c2)OCO3)s1 |
| InChI | InChI=1S/C15H17N3O3S/c1-2-16-5-6-17-14(19)13-8-18-15(22-13)10-3-4-11-12(7-10)21-9-20-11/h3-4,7-8,16H,2,5-6,9H2,1H3,(H,17,19) |
| InChIKey | WZXZJDOSRMJFPJ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|