C14H19Cl2N3OS — CID 119509156
N-[2-(ethylamino)ethyl]-2-phenyl-1,3-thiazole-5-carboxamide;dihydrochloride (PubChem CID 119509156) has the molecular formula C14H19Cl2N3OS and a molecular weight of 348.30 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-2-phenyl-1,3-thiazole-5-carboxamide;dihydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-2-phenyl-1,3-thiazole-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119509156 |
| Molecular Formula | C14H19Cl2N3OS |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-2-phenyl-1,3-thiazole-5-carboxamide;dihydrochloride |
| SMILES | CCNCCNC(=O)c1cnc(-c2ccccc2)s1.Cl.Cl |
| InChI | InChI=1S/C14H17N3OS.2ClH/c1-2-15-8-9-16-13(18)12-10-17-14(19-12)11-6-4-3-5-7-11;;/h3-7,10,15H,2,8-9H2,1H3,(H,16,18);2*1H |
| InChIKey | RQDGVXMEWAZRPE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|