C19H17N7O2S — CID 135800931
2-amino-N-ethyl-4-[(E)-N-hydroxy-C-(4-pyrazol-1-ylphenyl)carbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 135800931) has the molecular formula C19H17N7O2S and a molecular weight of 407.46 g/mol. Its IUPAC name is 2-amino-N-ethyl-4-[(E)-N-hydroxy-C-(4-pyrazol-1-ylphenyl)carbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-amino-N-ethyl-4-[(E)-N-hydroxy-C-(4-pyrazol-1-ylphenyl)carbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135800931 |
| Molecular Formula | C19H17N7O2S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-amino-N-ethyl-4-[(E)-N-hydroxy-C-(4-pyrazol-1-ylphenyl)carbonimidoyl]thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCNC(=O)c1cc2c(/C(=N/O)c3ccc(-n4cccn4)cc3)nc(N)nc2s1 |
| InChI | InChI=1S/C19H17N7O2S/c1-2-21-17(27)14-10-13-16(23-19(20)24-18(13)29-14)15(25-28)11-4-6-12(7-5-11)26-9-3-8-22-26/h3-10,28H,2H2,1H3,(H,21,27)(H2,20,23,24)/b25-15+ |
| InChIKey | MWSZHVNSEIEEHD-MFKUBSTISA-N |
| XLogP | 2.44 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|