C22H26N8O4 — CID 157086437
N-aminohydroxylamine;ethyl 4-pyrazol-1-ylbenzoate;4-pyrazol-1-ylbenzohydrazide (PubChem CID 157086437) has the molecular formula C22H26N8O4 and a molecular weight of 466.50 g/mol. Its IUPAC name is N-aminohydroxylamine;ethyl 4-pyrazol-1-ylbenzoate;4-pyrazol-1-ylbenzohydrazide.
| Compound Name | N-aminohydroxylamine;ethyl 4-pyrazol-1-ylbenzoate;4-pyrazol-1-ylbenzohydrazide |
|---|---|
| PubChem CID | 157086437 |
| Molecular Formula | C22H26N8O4 |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-aminohydroxylamine;ethyl 4-pyrazol-1-ylbenzoate;4-pyrazol-1-ylbenzohydrazide |
| SMILES | CCOC(=O)c1ccc(-n2cccn2)cc1.NNC(=O)c1ccc(-n2cccn2)cc1.NNO |
| InChI | InChI=1S/C12H12N2O2.C10H10N4O.H4N2O/c1-2-16-12(15)10-4-6-11(7-5-10)14-9-3-8-13-14;11-13-10(15)8-2-4-9(5-3-8)14-7-1-6-12-14;1-2-3/h3-9H,2H2,1H3;1-7H,11H2,(H,13,15);2-3H,1H2 |
| InChIKey | AEDIFTHNRYKXJX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 175.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|