C16H16N4OS — CID 58560936
N-ethyl-4-(4-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 58560936) has the molecular formula C16H16N4OS and a molecular weight of 312.40 g/mol. Its IUPAC name is N-ethyl-4-(4-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | N-ethyl-4-(4-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 58560936 |
| Molecular Formula | C16H16N4OS |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-ethyl-4-(4-methylanilino)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CCNC(=O)c1cc2c(Nc3ccc(C)cc3)ncnc2s1 |
| InChI | InChI=1S/C16H16N4OS/c1-3-17-15(21)13-8-12-14(18-9-19-16(12)22-13)20-11-6-4-10(2)5-7-11/h4-9H,3H2,1-2H3,(H,17,21)(H,18,19,20) |
| InChIKey | AUAADHFWEDRHOV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |