C17H19N5OS — CID 6539986
1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-butylurea (PubChem CID 6539986) has the molecular formula C17H19N5OS and a molecular weight of 341.44 g/mol. Its IUPAC name is 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-butylurea.
| Compound Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-butylurea |
|---|---|
| PubChem CID | 6539986 |
| Molecular Formula | C17H19N5OS |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-butylurea |
| SMILES | CCCCNC(=O)Nc1ccc(-c2csc3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C17H19N5OS/c1-2-3-8-19-17(23)22-12-6-4-11(5-7-12)13-9-24-16-14(13)15(18)20-10-21-16/h4-7,9-10H,2-3,8H2,1H3,(H2,18,20,21)(H2,19,22,23) |
| InChIKey | ZCANFQFOKQRQAW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|