C18H21N5OS — CID 69058580
1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylbutyl)urea (PubChem CID 69058580) has the molecular formula C18H21N5OS and a molecular weight of 355.47 g/mol. Its IUPAC name is 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylbutyl)urea.
| Compound Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylbutyl)urea |
|---|---|
| PubChem CID | 69058580 |
| Molecular Formula | C18H21N5OS |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 1-[4-(4-aminothieno[2,3-d]pyrimidin-5-yl)phenyl]-3-(3-methylbutyl)urea |
| SMILES | CC(C)CCNC(=O)Nc1ccc(-c2csc3ncnc(N)c23)cc1 |
| InChI | InChI=1S/C18H21N5OS/c1-11(2)7-8-20-18(24)23-13-5-3-12(4-6-13)14-9-25-17-15(14)16(19)21-10-22-17/h3-6,9-11H,7-8H2,1-2H3,(H2,19,21,22)(H2,20,23,24) |
| InChIKey | VIRHPFOYHCYUKG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |