C10H13N3OS — CID 60706910
N-ethyl-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 60706910) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is N-ethyl-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-ethyl-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 60706910 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-ethyl-1,3-dimethylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | CCNC(=O)c1cc2c(C)nn(C)c2s1 |
| InChI | InChI=1S/C10H13N3OS/c1-4-11-9(14)8-5-7-6(2)12-13(3)10(7)15-8/h5H,4H2,1-3H3,(H,11,14) |
| InChIKey | KARYCJGTZDZQIF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |