C9H11N3OS — CID 60708571
N,1,3-trimethylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 60708571) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is N,1,3-trimethylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N,1,3-trimethylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 60708571 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N,1,3-trimethylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | CNC(=O)c1cc2c(C)nn(C)c2s1 |
| InChI | InChI=1S/C9H11N3OS/c1-5-6-4-7(8(13)10-2)14-9(6)12(3)11-5/h4H,1-3H3,(H,10,13) |
| InChIKey | LUBWFFBJNCORPE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |