C22H15N3OS2 — CID 101005680
13-methyl-5,11-diphenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one (PubChem CID 101005680) has the molecular formula C22H15N3OS2 and a molecular weight of 401.52 g/mol. Its IUPAC name is 13-methyl-5,11-diphenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one.
| Compound Name | 13-methyl-5,11-diphenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
|---|---|
| PubChem CID | 101005680 |
| Molecular Formula | C22H15N3OS2 |
| Molecular Weight | 401.52 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 13-methyl-5,11-diphenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
| SMILES | Cc1cc(-c2ccccc2)nc2sc3c(=O)n(-c4ccccc4)c(=S)[nH]c3c12 |
| InChI | InChI=1S/C22H15N3OS2/c1-13-12-16(14-8-4-2-5-9-14)23-20-17(13)18-19(28-20)21(26)25(22(27)24-18)15-10-6-3-7-11-15/h2-12H,1H3,(H,24,27) |
| InChIKey | XQGSLCORCRSPCW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|