C29H21N3OS2 — CID 10624953
11-(4-methylphenyl)-4-methylsulfanyl-5,13-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 10624953) has the molecular formula C29H21N3OS2 and a molecular weight of 491.64 g/mol. Its IUPAC name is 11-(4-methylphenyl)-4-methylsulfanyl-5,13-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 11-(4-methylphenyl)-4-methylsulfanyl-5,13-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 10624953 |
| Molecular Formula | C29H21N3OS2 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 11-(4-methylphenyl)-4-methylsulfanyl-5,13-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | CSc1nc2c(sc3nc(-c4ccc(C)cc4)cc(-c4ccccc4)c32)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C29H21N3OS2/c1-18-13-15-20(16-14-18)23-17-22(19-9-5-3-6-10-19)24-25-26(35-27(24)30-23)28(33)32(29(31-25)34-2)21-11-7-4-8-12-21/h3-17H,1-2H3 |
| InChIKey | OOCAVEJFWSSSTJ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |