C29H21N3O2S2 — CID 10577547
11-(4-methoxyphenyl)-5-(3-methylphenyl)-13-phenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one (PubChem CID 10577547) has the molecular formula C29H21N3O2S2 and a molecular weight of 507.64 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-5-(3-methylphenyl)-13-phenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one.
| Compound Name | 11-(4-methoxyphenyl)-5-(3-methylphenyl)-13-phenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
|---|---|
| PubChem CID | 10577547 |
| Molecular Formula | C29H21N3O2S2 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 11-(4-methoxyphenyl)-5-(3-methylphenyl)-13-phenyl-4-sulfanylidene-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-6-one |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c3c(n2)sc2c(=O)n(-c4cccc(C)c4)c(=S)[nH]c23)cc1 |
| InChI | InChI=1S/C29H21N3O2S2/c1-17-7-6-10-20(15-17)32-28(33)26-25(31-29(32)35)24-22(18-8-4-3-5-9-18)16-23(30-27(24)36-26)19-11-13-21(34-2)14-12-19/h3-16H,1-2H3,(H,31,35) |
| InChIKey | AYIPOXVPWDGYDT-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|