C23H14N4OS3 — CID 10671581
9-methyl-14-(4-phenyl-1,3-thiazol-2-yl)-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one (PubChem CID 10671581) has the molecular formula C23H14N4OS3 and a molecular weight of 458.59 g/mol. Its IUPAC name is 9-methyl-14-(4-phenyl-1,3-thiazol-2-yl)-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one.
| Compound Name | 9-methyl-14-(4-phenyl-1,3-thiazol-2-yl)-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
|---|---|
| PubChem CID | 10671581 |
| Molecular Formula | C23H14N4OS3 |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.03 |
| IUPAC Name | 9-methyl-14-(4-phenyl-1,3-thiazol-2-yl)-13-sulfanylidene-17-thia-2,12,14-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16)-hexaen-15-one |
| SMILES | Cc1c2ccccc2nc2sc3c(=O)n(-c4nc(-c5ccccc5)cs4)c(=S)[nH]c3c12 |
| InChI | InChI=1S/C23H14N4OS3/c1-12-14-9-5-6-10-15(14)24-20-17(12)18-19(31-20)21(28)27(22(29)26-18)23-25-16(11-30-23)13-7-3-2-4-8-13/h2-11H,1H3,(H,26,29) |
| InChIKey | ZIUSNTUPPHEMGV-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|