C19H14N2S — CID 103597581
2-(2-methylquinolin-4-yl)-4-phenyl-1,3-thiazole (PubChem CID 103597581) has the molecular formula C19H14N2S and a molecular weight of 302.40 g/mol. Its IUPAC name is 2-(2-methylquinolin-4-yl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-(2-methylquinolin-4-yl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 103597581 |
| Molecular Formula | C19H14N2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 2-(2-methylquinolin-4-yl)-4-phenyl-1,3-thiazole |
| SMILES | Cc1cc(-c2nc(-c3ccccc3)cs2)c2ccccc2n1 |
| InChI | InChI=1S/C19H14N2S/c1-13-11-16(15-9-5-6-10-17(15)20-13)19-21-18(12-22-19)14-7-3-2-4-8-14/h2-12H,1H3 |
| InChIKey | KXODTQBUILZXCH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |