C12H10N4S — CID 79235359
3-(2-methylquinolin-4-yl)-1,2,4-thiadiazol-5-amine (PubChem CID 79235359) has the molecular formula C12H10N4S and a molecular weight of 242.31 g/mol. Its IUPAC name is 3-(2-methylquinolin-4-yl)-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-(2-methylquinolin-4-yl)-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 79235359 |
| Molecular Formula | C12H10N4S |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-(2-methylquinolin-4-yl)-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1cc(-c2nsc(N)n2)c2ccccc2n1 |
| InChI | InChI=1S/C12H10N4S/c1-7-6-9(11-15-12(13)17-16-11)8-4-2-3-5-10(8)14-7/h2-6H,1H3,(H2,13,15,16) |
| InChIKey | IOWUCZSPJALIEH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |