C21H18N2O3S — CID 103597586
2,6-dimethoxy-3-[2-(2-methylquinolin-4-yl)-1,3-thiazol-4-yl]phenol (PubChem CID 103597586) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2,6-dimethoxy-3-[2-(2-methylquinolin-4-yl)-1,3-thiazol-4-yl]phenol.
| Compound Name | 2,6-dimethoxy-3-[2-(2-methylquinolin-4-yl)-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 103597586 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2,6-dimethoxy-3-[2-(2-methylquinolin-4-yl)-1,3-thiazol-4-yl]phenol |
| SMILES | COc1ccc(-c2csc(-c3cc(C)nc4ccccc34)n2)c(OC)c1O |
| InChI | InChI=1S/C21H18N2O3S/c1-12-10-15(13-6-4-5-7-16(13)22-12)21-23-17(11-27-21)14-8-9-18(25-2)19(24)20(14)26-3/h4-11,24H,1-3H3 |
| InChIKey | HQNWMHVBMBBXPP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |