About 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole
5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole (PubChem CID 122146031) has the molecular formula C15H14N2O3S
and a molecular weight of 302.36 g/mol. Its IUPAC name is 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole.
Molecular Properties
| Compound Name | 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole |
| PubChem CID | 122146031 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole |
| SMILES | COc1cccc(-c2nc(-c3cc(C)no3)cs2)c1OC |
| InChI | InChI=1S/C15H14N2O3S/c1-9-7-13(20-17-9)11-8-21-15(16-11)10-5-4-6-12(18-2)14(10)19-3/h4-8H,1-3H3 |
| InChIKey | BSECTDOHVVRDTR-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole?
The IUPAC name of 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole (CID 122146031) is 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole.
What is the SMILES notation for 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole?
The canonical SMILES for 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole is COc1cccc(-c2nc(-c3cc(C)no3)cs2)c1OC.
What is the InChIKey of 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole?
The InChIKey is BSECTDOHVVRDTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O3S/c1-9-7-13(20-17-9)11-8-21-15(16-11)10-5-4-6-12(18-2)14(10)19-3/h4-8H,1-3H3.
What are the key properties of 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole?
5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole has a molecular weight of 302.36 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,3-dimethoxyphenyl)-1,3-thiazol-4-yl]-3-methyl-1,2-oxazole is sourced from PubChem (CID 122146031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).