C32H25N3O3S2 — CID 177256096
ethyl 2-[[13-(4-methoxyphenyl)-6,11-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]sulfanyl]acetate (PubChem CID 177256096) has the molecular formula C32H25N3O3S2 and a molecular weight of 563.70 g/mol. Its IUPAC name is ethyl 2-[[13-(4-methoxyphenyl)-6,11-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]sulfanyl]acetate.
| Compound Name | ethyl 2-[[13-(4-methoxyphenyl)-6,11-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 177256096 |
| Molecular Formula | C32H25N3O3S2 |
| Molecular Weight | 563.70 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | ethyl 2-[[13-(4-methoxyphenyl)-6,11-diphenyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-4-yl]sulfanyl]acetate |
| SMILES | CCOC(=O)CSc1nc(-c2ccccc2)c2sc3nc(-c4ccccc4)cc(-c4ccc(OC)cc4)c3c2n1 |
| InChI | InChI=1S/C32H25N3O3S2/c1-3-38-26(36)19-39-32-34-28(22-12-8-5-9-13-22)30-29(35-32)27-24(20-14-16-23(37-2)17-15-20)18-25(33-31(27)40-30)21-10-6-4-7-11-21/h4-18H,3,19H2,1-2H3 |
| InChIKey | FJNHBEJOQMDUGX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.70 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |