C13H10N2OS — CID 12933993
4-methyl-6-phenyl-[1,2]thiazolo[5,4-b]pyridin-3-one (PubChem CID 12933993) has the molecular formula C13H10N2OS and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-methyl-6-phenyl-[1,2]thiazolo[5,4-b]pyridin-3-one.
| Compound Name | 4-methyl-6-phenyl-[1,2]thiazolo[5,4-b]pyridin-3-one |
|---|---|
| PubChem CID | 12933993 |
| Molecular Formula | C13H10N2OS |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 4-methyl-6-phenyl-[1,2]thiazolo[5,4-b]pyridin-3-one |
| SMILES | Cc1cc(-c2ccccc2)nc2s[nH]c(=O)c12 |
| InChI | InChI=1S/C13H10N2OS/c1-8-7-10(9-5-3-2-4-6-9)14-13-11(8)12(16)15-17-13/h2-7H,1H3,(H,15,16) |
| InChIKey | JMWHDBHQOBJHOV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |