C17H12N4OS — CID 134914738
8-methyl-3-phenyl-2-sulfanylidene-1H-pyrimido[5,4-c]cinnolin-4-one (PubChem CID 134914738) has the molecular formula C17H12N4OS and a molecular weight of 320.38 g/mol. Its IUPAC name is 8-methyl-3-phenyl-2-sulfanylidene-1H-pyrimido[5,4-c]cinnolin-4-one.
| Compound Name | 8-methyl-3-phenyl-2-sulfanylidene-1H-pyrimido[5,4-c]cinnolin-4-one |
|---|---|
| PubChem CID | 134914738 |
| Molecular Formula | C17H12N4OS |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 8-methyl-3-phenyl-2-sulfanylidene-1H-pyrimido[5,4-c]cinnolin-4-one |
| SMILES | Cc1ccc2c(c1)nnc1c(=O)n(-c3ccccc3)c(=S)[nH]c12 |
| InChI | InChI=1S/C17H12N4OS/c1-10-7-8-12-13(9-10)19-20-15-14(12)18-17(23)21(16(15)22)11-5-3-2-4-6-11/h2-9H,1H3,(H,18,23) |
| InChIKey | BMQFVAMZGMJZDU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|