C19H19N3O — CID 54513102
ethane;7-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 54513102) has the molecular formula C19H19N3O and a molecular weight of 305.38 g/mol. Its IUPAC name is ethane;7-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one.
| Compound Name | ethane;7-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 54513102 |
| Molecular Formula | C19H19N3O |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | ethane;7-methyl-2-phenyl-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | CC.Cc1ccc2c(c1)ncc1c(=O)n(-c3ccccc3)[nH]c12 |
| InChI | InChI=1S/C17H13N3O.C2H6/c1-11-7-8-13-15(9-11)18-10-14-16(13)19-20(17(14)21)12-5-3-2-4-6-12;1-2/h2-10,19H,1H3;1-2H3 |
| InChIKey | KOMSRSGLKUJAAU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|