C18H12N4OS — CID 52916658
2-(1,3-benzothiazol-2-yl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one (PubChem CID 52916658) has the molecular formula C18H12N4OS and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one |
|---|---|
| PubChem CID | 52916658 |
| Molecular Formula | C18H12N4OS |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-8-methyl-1H-pyrazolo[4,3-c]quinolin-3-one |
| SMILES | Cc1ccc2ncc3c(=O)n(-c4nc5ccccc5s4)[nH]c3c2c1 |
| InChI | InChI=1S/C18H12N4OS/c1-10-6-7-13-11(8-10)16-12(9-19-13)17(23)22(21-16)18-20-14-4-2-3-5-15(14)24-18/h2-9,21H,1H3 |
| InChIKey | BVSTZZHJPJQUSC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|